Home
Products
Astragaloside
| Product Name | Astragaloside |
| Price: | Inquiry |
| Catalog No.: | CN05540 |
| CAS No.: | 17429-69-5 |
| Molecular Formula: | C28H32O17 |
| Molecular Weight: | 640.55 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Astragalus membranaceus (Fisch.) Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(oc4c(c3=O)c(O)cc(c4)O)c3ccc(c(c3)OC)O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Astragaloside protects the morphological structures and restores acetylcholine level in rat hippocampus, and improves brain functions via normalizing brain EEG[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1000.6±65.0 °C at 760 mmHg |
| Flash Point | 327.5±27.8 °C |
| Exact Mass | 640.163940 |
| PSA | 278.66000 |
| LogP | -0.76 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |